C19H20N2 — CID 18878588
2-cyclopropyl-1-[(2,5-dimethylphenyl)methyl]benzimidazole (PubChem CID 18878588) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-cyclopropyl-1-[(2,5-dimethylphenyl)methyl]benzimidazole.
| Compound Name | 2-cyclopropyl-1-[(2,5-dimethylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 18878588 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-cyclopropyl-1-[(2,5-dimethylphenyl)methyl]benzimidazole |
| SMILES | Cc1ccc(C)c(Cn2c(C3CC3)nc3ccccc32)c1 |
| InChI | InChI=1S/C19H20N2/c1-13-7-8-14(2)16(11-13)12-21-18-6-4-3-5-17(18)20-19(21)15-9-10-15/h3-8,11,15H,9-10,12H2,1-2H3 |
| InChIKey | KXOMXTUPPOOPLE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |