C27H26N4O3 — CID 170022045
N-[6-[5-(2-ethoxyphenoxy)-3-pyridinyl]pyrazin-2-yl]-2-(4-ethylphenyl)acetamide (PubChem CID 170022045) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[6-[5-(2-ethoxyphenoxy)-3-pyridinyl]pyrazin-2-yl]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[6-[5-(2-ethoxyphenoxy)-3-pyridinyl]pyrazin-2-yl]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 170022045 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[6-[5-(2-ethoxyphenoxy)-3-pyridinyl]pyrazin-2-yl]-2-(4-ethylphenyl)acetamide |
| SMILES | CCOc1ccccc1Oc1cncc(-c2cncc(NC(=O)Cc3ccc(CC)cc3)n2)c1 |
| InChI | InChI=1S/C27H26N4O3/c1-3-19-9-11-20(12-10-19)13-27(32)31-26-18-29-17-23(30-26)21-14-22(16-28-15-21)34-25-8-6-5-7-24(25)33-4-2/h5-12,14-18H,3-4,13H2,1-2H3,(H,30,31,32) |
| InChIKey | PSKWPGVXJDMVLU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |