C20H24FN7O — CID 170024085
[6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(2-fluoroethylamino)methanol (PubChem CID 170024085) has the molecular formula C20H24FN7O and a molecular weight of 397.46 g/mol. Its IUPAC name is [6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(2-fluoroethylamino)methanol.
| Compound Name | [6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(2-fluoroethylamino)methanol |
|---|---|
| PubChem CID | 170024085 |
| Molecular Formula | C20H24FN7O |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | [6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(2-fluoroethylamino)methanol |
| SMILES | CC(C)(C)n1nc(-c2ccc3cc(C(O)NCCF)[nH]c3c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C20H24FN7O/c1-20(2,3)28-18-15(17(22)24-10-25-18)16(27-28)12-5-4-11-8-14(26-13(11)9-12)19(29)23-7-6-21/h4-5,8-10,19,23,26,29H,6-7H2,1-3H3,(H2,22,24,25) |
| InChIKey | CLUHRELBSRVLER-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|