C25H27N7O — CID 170024094
[6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(benzylamino)methanol (PubChem CID 170024094) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is [6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(benzylamino)methanol.
| Compound Name | [6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(benzylamino)methanol |
|---|---|
| PubChem CID | 170024094 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [6-(4-amino-1-tert-butylpyrazolo[3,4-d]pyrimidin-3-yl)-1H-indol-2-yl]-(benzylamino)methanol |
| SMILES | CC(C)(C)n1nc(-c2ccc3cc(C(O)NCc4ccccc4)[nH]c3c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C25H27N7O/c1-25(2,3)32-23-20(22(26)28-14-29-23)21(31-32)17-10-9-16-11-19(30-18(16)12-17)24(33)27-13-15-7-5-4-6-8-15/h4-12,14,24,27,30,33H,13H2,1-3H3,(H2,26,28,29) |
| InChIKey | OOTKDUZJOKMBEZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|