C27H25N3O2 — CID 17003107
1-(2,5-dimethylphenyl)-4-(1-phenacylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 17003107) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-(1-phenacylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | 1-(2,5-dimethylphenyl)-4-(1-phenacylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003107 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-(1-phenacylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | Cc1ccc(C)c(N2CC(c3nc4ccccc4n3CC(=O)c3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C27H25N3O2/c1-18-12-13-19(2)24(14-18)29-16-21(15-26(29)32)27-28-22-10-6-7-11-23(22)30(27)17-25(31)20-8-4-3-5-9-20/h3-14,21H,15-17H2,1-2H3 |
| InChIKey | RBJDLRAGSIIQDX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |