C27H24ClN3O2 — CID 17003641
4-[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]-1-(2-ethylphenyl)pyrrolidin-2-one (PubChem CID 17003641) has the molecular formula C27H24ClN3O2 and a molecular weight of 457.96 g/mol. Its IUPAC name is 4-[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]-1-(2-ethylphenyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]-1-(2-ethylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003641 |
| Molecular Formula | C27H24ClN3O2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 4-[1-[2-(4-chlorophenyl)-2-oxoethyl]benzimidazol-2-yl]-1-(2-ethylphenyl)pyrrolidin-2-one |
| SMILES | CCc1ccccc1N1CC(c2nc3ccccc3n2CC(=O)c2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C27H24ClN3O2/c1-2-18-7-3-5-9-23(18)30-16-20(15-26(30)33)27-29-22-8-4-6-10-24(22)31(27)17-25(32)19-11-13-21(28)14-12-19/h3-14,20H,2,15-17H2,1H3 |
| InChIKey | DWDCIBGWGQHXSP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |