C26H32ClN3O — CID 18889044
1-(4-chlorophenyl)-4-(1-nonylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 18889044) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(1-nonylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | 1-(4-chlorophenyl)-4-(1-nonylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 18889044 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(1-nonylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCCCCCCCn1c(C2CC(=O)N(c3ccc(Cl)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C26H32ClN3O/c1-2-3-4-5-6-7-10-17-29-24-12-9-8-11-23(24)28-26(29)20-18-25(31)30(19-20)22-15-13-21(27)14-16-22/h8-9,11-16,20H,2-7,10,17-19H2,1H3 |
| InChIKey | PMNQGXYLQZTYSC-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|