C26H33N3O — CID 94371555
(4S)-1-(4-methylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 94371555) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is (4S)-1-(4-methylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | (4S)-1-(4-methylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 94371555 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (4S)-1-(4-methylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCCCCCCn1c([C@H]2CC(=O)N(c3ccc(C)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C26H33N3O/c1-3-4-5-6-7-10-17-28-24-12-9-8-11-23(24)27-26(28)21-18-25(30)29(19-21)22-15-13-20(2)14-16-22/h8-9,11-16,21H,3-7,10,17-19H2,1-2H3/t21-/m0/s1 |
| InChIKey | KRKIVNMLBZEZOA-NRFANRHFSA-N |
| XLogP | 6.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|