C22H24FN3O — CID 40698975
(4S)-1-(4-fluorophenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 40698975) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is (4S)-1-(4-fluorophenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | (4S)-1-(4-fluorophenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 40698975 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | (4S)-1-(4-fluorophenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCCCn1c([C@H]2CC(=O)N(c3ccc(F)cc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C22H24FN3O/c1-2-3-6-13-25-20-8-5-4-7-19(20)24-22(25)16-14-21(27)26(15-16)18-11-9-17(23)10-12-18/h4-5,7-12,16H,2-3,6,13-15H2,1H3/t16-/m0/s1 |
| InChIKey | RGMZWUXXYQCGQJ-INIZCTEOSA-N |
| XLogP | 4.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|