C27H35N3O — CID 17004183
1-(3,5-dimethylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 17004183) has the molecular formula C27H35N3O and a molecular weight of 417.60 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17004183 |
| Molecular Formula | C27H35N3O |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4-(1-octylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCCCCCCn1c(C2CC(=O)N(c3cc(C)cc(C)c3)C2)nc2ccccc21 |
| InChI | InChI=1S/C27H35N3O/c1-4-5-6-7-8-11-14-29-25-13-10-9-12-24(25)28-27(29)22-18-26(31)30(19-22)23-16-20(2)15-21(3)17-23/h9-10,12-13,15-17,22H,4-8,11,14,18-19H2,1-3H3 |
| InChIKey | HXKGMOMHSYKBPI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|