C24H29N3O — CID 27407290
(4S)-1-(2,6-dimethylphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 27407290) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (4S)-1-(2,6-dimethylphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | (4S)-1-(2,6-dimethylphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 27407290 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (4S)-1-(2,6-dimethylphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCCCn1c([C@H]2CC(=O)N(c3c(C)cccc3C)C2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N3O/c1-4-5-8-14-26-21-13-7-6-12-20(21)25-24(26)19-15-22(28)27(16-19)23-17(2)10-9-11-18(23)3/h6-7,9-13,19H,4-5,8,14-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | VVEHKXIPUDGGFD-IBGZPJMESA-N |
| XLogP | 5.36 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|