C20H30N4O3S — CID 170031712
tert-butyl (2S,3S,4S)-4-amino-3-(2,3-dihydro-1-benzofuran-4-ylcarbamothioylamino)-2-methylpiperidine-1-carboxylate (PubChem CID 170031712) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-4-amino-3-(2,3-dihydro-1-benzofuran-4-ylcarbamothioylamino)-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S)-4-amino-3-(2,3-dihydro-1-benzofuran-4-ylcarbamothioylamino)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170031712 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | tert-butyl (2S,3S,4S)-4-amino-3-(2,3-dihydro-1-benzofuran-4-ylcarbamothioylamino)-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](NC(=S)Nc2cccc3c2CCO3)[C@@H](N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30N4O3S/c1-12-17(14(21)8-10-24(12)19(25)27-20(2,3)4)23-18(28)22-15-6-5-7-16-13(15)9-11-26-16/h5-7,12,14,17H,8-11,21H2,1-4H3,(H2,22,23,28)/t12-,14-,17+/m0/s1 |
| InChIKey | PJULRRVYMFNYHM-RVSPLBMKSA-N |
| XLogP | 2.63 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|