C20H32N4O3S — CID 170031722
tert-butyl (2R,4S,5R)-4-amino-5-[[(2,3-dihydro-1-benzofuran-4-ylamino)-sulfanylmethyl]amino]-2-methylpiperidine-1-carboxylate (PubChem CID 170031722) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is tert-butyl (2R,4S,5R)-4-amino-5-[[(2,3-dihydro-1-benzofuran-4-ylamino)-sulfanylmethyl]amino]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S,5R)-4-amino-5-[[(2,3-dihydro-1-benzofuran-4-ylamino)-sulfanylmethyl]amino]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170031722 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | tert-butyl (2R,4S,5R)-4-amino-5-[[(2,3-dihydro-1-benzofuran-4-ylamino)-sulfanylmethyl]amino]-2-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@H](N)[C@H](NC(S)Nc2cccc3c2CCO3)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N4O3S/c1-12-10-14(21)16(11-24(12)19(25)27-20(2,3)4)23-18(28)22-15-6-5-7-17-13(15)8-9-26-17/h5-7,12,14,16,18,22-23,28H,8-11,21H2,1-4H3/t12-,14+,16-,18?/m1/s1 |
| InChIKey | BKSSRTSHTVBKPO-BUZLZWBJSA-N |
| XLogP | 2.56 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|