C37H31Cl2FN2O3 — CID 170032032
CID 170032032 (PubChem CID 170032032) has the molecular formula C37H31Cl2FN2O3 and a molecular weight of 641.57 g/mol.
| Compound Name | CID 170032032 |
|---|---|
| PubChem CID | 170032032 |
| Molecular Formula | C37H31Cl2FN2O3 |
| Molecular Weight | 641.57 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | — |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1C(c1cccc(Cl)c1F)C1(C(=O)Nc3cc(Cl)ccc31)C21CCCCC1 |
| InChI | InChI=1S/C37H31Cl2FN2O3/c38-24-17-18-26-28(21-24)41-35(44)37(26)29(25-15-10-16-27(39)30(25)40)32-34(43)45-33(23-13-6-2-7-14-23)31(22-11-4-1-5-12-22)42(32)36(37)19-8-3-9-20-36/h1-2,4-7,10-18,21,29,31-33H,3,8-9,19-20H2,(H,41,44)/t29?,31-,32-,33+,37?/m1/s1 |
| InChIKey | NIMTVIUBKPSGRH-GOPVAPLMSA-N |
| XLogP | 8.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.57 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |