C31H36Cl2FN3O3 — CID 175866271
CID 175866271 (PubChem CID 175866271) has the molecular formula C31H36Cl2FN3O3 and a molecular weight of 588.55 g/mol.
| Compound Name | CID 175866271 |
|---|---|
| PubChem CID | 175866271 |
| Molecular Formula | C31H36Cl2FN3O3 |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | — |
| SMILES | CN1[C@@H](C(=O)NC2CCC(CO)CC2)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2 |
| InChI | InChI=1S/C31H36Cl2FN3O3/c1-37-27(28(39)35-20-11-8-18(17-38)9-12-20)25(21-6-5-7-23(33)26(21)34)31(30(37)14-3-2-4-15-30)22-13-10-19(32)16-24(22)36-29(31)40/h5-7,10,13,16,18,20,25,27,38H,2-4,8-9,11-12,14-15,17H2,1H3,(H,35,39)(H,36,40)/t18?,20?,25-,27+,31+/m0/s1 |
| InChIKey | XRWTXLVGAQELCA-YOHBTLJGSA-N |
| XLogP | 5.79 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |