C16H17N3OS — CID 170032509
4-amino-1-[4-[1-(2-methylprop-1-enylsulfanyl)ethenyl]phenyl]pyrimidin-2-one (PubChem CID 170032509) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-amino-1-[4-[1-(2-methylprop-1-enylsulfanyl)ethenyl]phenyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[4-[1-(2-methylprop-1-enylsulfanyl)ethenyl]phenyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 170032509 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 4-amino-1-[4-[1-(2-methylprop-1-enylsulfanyl)ethenyl]phenyl]pyrimidin-2-one |
| SMILES | C=C(SC=C(C)C)c1ccc(-n2ccc(N)nc2=O)cc1 |
| InChI | InChI=1S/C16H17N3OS/c1-11(2)10-21-12(3)13-4-6-14(7-5-13)19-9-8-15(17)18-16(19)20/h4-10H,3H2,1-2H3,(H2,17,18,20) |
| InChIKey | JBOIKOXRNWATOW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |