C7H9N3O — CID 145434228
4-amino-1-prop-1-en-2-ylpyrimidin-2-one (PubChem CID 145434228) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 4-amino-1-prop-1-en-2-ylpyrimidin-2-one.
| Compound Name | 4-amino-1-prop-1-en-2-ylpyrimidin-2-one |
|---|---|
| PubChem CID | 145434228 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 4-amino-1-prop-1-en-2-ylpyrimidin-2-one |
| SMILES | C=C(C)n1ccc(N)nc1=O |
| InChI | InChI=1S/C7H9N3O/c1-5(2)10-4-3-6(8)9-7(10)11/h3-4H,1H2,2H3,(H2,8,9,11) |
| InChIKey | XBUBBVGIANUVNW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |