About 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine
1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine (PubChem CID 170033446) has the molecular formula C8H18F2N2
and a molecular weight of 180.24 g/mol. Its IUPAC name is 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine.
Molecular Properties
| Compound Name | 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine |
| PubChem CID | 170033446 |
| Molecular Formula | C8H18F2N2 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine |
| SMILES | CCCNN(CC)[C@@H](C)C(F)F |
| InChI | InChI=1S/C8H18F2N2/c1-4-6-11-12(5-2)7(3)8(9)10/h7-8,11H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | ZGABQJIJWAENLS-ZETCQYMHSA-N |
| XLogP | 1.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine?
The IUPAC name of 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine (CID 170033446) is 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine.
What is the SMILES notation for 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine?
The canonical SMILES for 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine is CCCNN(CC)[C@@H](C)C(F)F.
What is the InChIKey of 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine?
The InChIKey is ZGABQJIJWAENLS-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H18F2N2/c1-4-6-11-12(5-2)7(3)8(9)10/h7-8,11H,4-6H2,1-3H3/t7-/m0/s1.
What are the key properties of 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine?
1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine has a molecular weight of 180.24 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-1,1-difluoropropan-2-yl]-1-ethyl-2-propylhydrazine is sourced from PubChem (CID 170033446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).