C30H30ClN3O2 — CID 17003544
1-(2-chlorophenyl)-4-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17003544) has the molecular formula C30H30ClN3O2 and a molecular weight of 500.04 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(2-chlorophenyl)-4-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003544 |
| Molecular Formula | C30H30ClN3O2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 1-(2-chlorophenyl)-4-[1-[4-(2-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | C=CCc1ccccc1OCCCCn1c(C2CC(=O)N(c3ccccc3Cl)C2)nc2ccccc21 |
| InChI | InChI=1S/C30H30ClN3O2/c1-2-11-22-12-3-8-17-28(22)36-19-10-9-18-33-27-16-7-5-14-25(27)32-30(33)23-20-29(35)34(21-23)26-15-6-4-13-24(26)31/h2-8,12-17,23H,1,9-11,18-21H2 |
| InChIKey | ZPOAETCBJMWLCS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|