C29H30ClN3O2 — CID 17003547
1-(2-chlorophenyl)-4-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17003547) has the molecular formula C29H30ClN3O2 and a molecular weight of 488.03 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(2-chlorophenyl)-4-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003547 |
| Molecular Formula | C29H30ClN3O2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 1-(2-chlorophenyl)-4-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | Cc1ccc(OCCCCn2c(C3CC(=O)N(c4ccccc4Cl)C3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C29H30ClN3O2/c1-20-13-14-23(17-21(20)2)35-16-8-7-15-32-27-12-6-4-10-25(27)31-29(32)22-18-28(34)33(19-22)26-11-5-3-9-24(26)30/h3-6,9-14,17,22H,7-8,15-16,18-19H2,1-2H3 |
| InChIKey | LEFXNGAFJBLHGP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|