C28H27Cl2N3O2 — CID 18889198
4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(3-chlorophenyl)pyrrolidin-2-one (PubChem CID 18889198) has the molecular formula C28H27Cl2N3O2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(3-chlorophenyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(3-chlorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 18889198 |
| Molecular Formula | C28H27Cl2N3O2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(3-chlorophenyl)pyrrolidin-2-one |
| SMILES | Cc1cc(OCCCCn2c(C3CC(=O)N(c4cccc(Cl)c4)C3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C28H27Cl2N3O2/c1-19-15-23(11-12-24(19)30)35-14-5-4-13-32-26-10-3-2-9-25(26)31-28(32)20-16-27(34)33(18-20)22-8-6-7-21(29)17-22/h2-3,6-12,15,17,20H,4-5,13-14,16,18H2,1H3 |
| InChIKey | QNMGDCXMUQZUTQ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|