C15H21N3O — CID 170035629
6-benzyl-2-methyl-2,6,9-triazaspiro[4.5]decan-1-one (PubChem CID 170035629) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 6-benzyl-2-methyl-2,6,9-triazaspiro[4.5]decan-1-one.
| Compound Name | 6-benzyl-2-methyl-2,6,9-triazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 170035629 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 6-benzyl-2-methyl-2,6,9-triazaspiro[4.5]decan-1-one |
| SMILES | CN1CCC2(CNCCN2Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H21N3O/c1-17-9-7-15(14(17)19)12-16-8-10-18(15)11-13-5-3-2-4-6-13/h2-6,16H,7-12H2,1H3 |
| InChIKey | NPJJHMGOTUVSNY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |