About 6-benzyl-6,9-diazaspiro[4.5]decan-4-one
6-benzyl-6,9-diazaspiro[4.5]decan-4-one (PubChem CID 158678480) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 6-benzyl-6,9-diazaspiro[4.5]decan-4-one.
Molecular Properties
| Compound Name | 6-benzyl-6,9-diazaspiro[4.5]decan-4-one |
| PubChem CID | 158678480 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 6-benzyl-6,9-diazaspiro[4.5]decan-4-one |
| SMILES | O=C1CCCC12CNCCN2Cc1ccccc1 |
| InChI | InChI=1S/C15H20N2O/c18-14-7-4-8-15(14)12-16-9-10-17(15)11-13-5-2-1-3-6-13/h1-3,5-6,16H,4,7-12H2 |
| InChIKey | TZNIKPUCSFIMNE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-benzyl-6,9-diazaspiro[4.5]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-6,9-diazaspiro[4.5]decan-4-one?
The IUPAC name of 6-benzyl-6,9-diazaspiro[4.5]decan-4-one (CID 158678480) is 6-benzyl-6,9-diazaspiro[4.5]decan-4-one.
What is the SMILES notation for 6-benzyl-6,9-diazaspiro[4.5]decan-4-one?
The canonical SMILES for 6-benzyl-6,9-diazaspiro[4.5]decan-4-one is O=C1CCCC12CNCCN2Cc1ccccc1.
What is the InChIKey of 6-benzyl-6,9-diazaspiro[4.5]decan-4-one?
The InChIKey is TZNIKPUCSFIMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c18-14-7-4-8-15(14)12-16-9-10-17(15)11-13-5-2-1-3-6-13/h1-3,5-6,16H,4,7-12H2.
What are the key properties of 6-benzyl-6,9-diazaspiro[4.5]decan-4-one?
6-benzyl-6,9-diazaspiro[4.5]decan-4-one has a molecular weight of 244.34 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-6,9-diazaspiro[4.5]decan-4-one is sourced from PubChem (CID 158678480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).