C14H20N2S — CID 169318676
4-benzyl-1-thia-4,9-diazaspiro[4.5]decane (PubChem CID 169318676) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-benzyl-1-thia-4,9-diazaspiro[4.5]decane.
| Compound Name | 4-benzyl-1-thia-4,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 169318676 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-benzyl-1-thia-4,9-diazaspiro[4.5]decane |
| SMILES | c1ccc(CN2CCSC23CCCNC3)cc1 |
| InChI | InChI=1S/C14H20N2S/c1-2-5-13(6-3-1)11-16-9-10-17-14(16)7-4-8-15-12-14/h1-3,5-6,15H,4,7-12H2 |
| InChIKey | XYVCZUUGAPSKGA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |