C24H23FN4O — CID 170036285
(3R)-4-[6-(3-fluoro-7H-cyclopenta[c]pyridin-4-yl)-4-(2-methyl-3-pyridinyl)-2-pyridinyl]-3-methylmorpholine (PubChem CID 170036285) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is (3R)-4-[6-(3-fluoro-7H-cyclopenta[c]pyridin-4-yl)-4-(2-methyl-3-pyridinyl)-2-pyridinyl]-3-methylmorpholine.
| Compound Name | (3R)-4-[6-(3-fluoro-7H-cyclopenta[c]pyridin-4-yl)-4-(2-methyl-3-pyridinyl)-2-pyridinyl]-3-methylmorpholine |
|---|---|
| PubChem CID | 170036285 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (3R)-4-[6-(3-fluoro-7H-cyclopenta[c]pyridin-4-yl)-4-(2-methyl-3-pyridinyl)-2-pyridinyl]-3-methylmorpholine |
| SMILES | Cc1ncccc1-c1cc(-c2c(F)ncc3c2C=CC3)nc(N2CCOC[C@H]2C)c1 |
| InChI | InChI=1S/C24H23FN4O/c1-15-14-30-10-9-29(15)22-12-18(19-7-4-8-26-16(19)2)11-21(28-22)23-20-6-3-5-17(20)13-27-24(23)25/h3-4,6-8,11-13,15H,5,9-10,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | SHGWWEWGGYFWID-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|