C22H36N2O2 — CID 170036292
N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]spiro[3.3]heptane-2-carboxamide (PubChem CID 170036292) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]spiro[3.3]heptane-2-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]spiro[3.3]heptane-2-carboxamide |
|---|---|
| PubChem CID | 170036292 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R,5S)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]spiro[3.3]heptane-2-carboxamide |
| SMILES | C[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C1CC3(CCC3)C1)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C22H36N2O2/c1-13-16-15(21(16,5)6)12-24(13)19(26)17(20(2,3)4)23-18(25)14-10-22(11-14)8-7-9-22/h13-17H,7-12H2,1-6H3,(H,23,25)/t13-,15+,16-,17-/m1/s1 |
| InChIKey | VFPJECQWPFHQQH-XLNGHYISSA-N |
| XLogP | 3.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |