C49H42S — CID 170036714
4-[9,9-bis(4-tert-butylphenyl)fluoren-4-yl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 170036714) has the molecular formula C49H42S and a molecular weight of 662.94 g/mol. Its IUPAC name is 4-[9,9-bis(4-tert-butylphenyl)fluoren-4-yl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 4-[9,9-bis(4-tert-butylphenyl)fluoren-4-yl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 170036714 |
| Molecular Formula | C49H42S |
| Molecular Weight | 662.94 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | 4-[9,9-bis(4-tert-butylphenyl)fluoren-4-yl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3c(-c4ccc5c(c4)-c4cccc6cccc(c46)S5)cccc32)cc1 |
| InChI | InChI=1S/C49H42S/c1-47(2,3)33-21-25-35(26-22-33)49(36-27-23-34(24-28-36)48(4,5)6)41-17-8-7-14-39(41)46-37(15-11-18-42(46)49)32-20-29-43-40(30-32)38-16-9-12-31-13-10-19-44(50-43)45(31)38/h7-30H,1-6H3 |
| InChIKey | KSXUOVOYCCKINP-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.94 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |