C55H44S — CID 177127479
4-[4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 177127479) has the molecular formula C55H44S and a molecular weight of 737.02 g/mol. Its IUPAC name is 4-[4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 4-[4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 177127479 |
| Molecular Formula | C55H44S |
| Molecular Weight | 737.02 g/mol |
| Exact Mass | 736.32 |
| IUPAC Name | 4-[4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4ccc(-c5ccc6c(c5)-c5cccc7cccc(c57)S6)cc4)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C55H44S/c1-53(2,3)38-23-26-42-43-27-24-39(54(4,5)6)32-49(43)55(48(42)31-38)46-15-8-7-13-40(46)41-25-21-37(30-47(41)55)34-19-17-33(18-20-34)36-22-28-50-45(29-36)44-14-9-11-35-12-10-16-51(56-50)52(35)44/h7-32H,1-6H3 |
| InChIKey | GANGQIXMHHRPFO-UHFFFAOYSA-N |
| XLogP | 15.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.02 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |