C24H29N3O3 — CID 17003806
1-(2,5-dimethoxyphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one (PubChem CID 17003806) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003806 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-4-(1-pentylbenzimidazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCCCn1c(C2CC(=O)N(c3cc(OC)ccc3OC)C2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N3O3/c1-4-5-8-13-26-20-10-7-6-9-19(20)25-24(26)17-14-23(28)27(16-17)21-15-18(29-2)11-12-22(21)30-3/h6-7,9-12,15,17H,4-5,8,13-14,16H2,1-3H3 |
| InChIKey | VGZUPIYCOOTUJY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|