C31H35N3O4 — CID 17003872
1-(2,5-dimethoxyphenyl)-4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17003872) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(2,5-dimethoxyphenyl)-4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17003872 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | COc1ccc(OC)c(N2CC(c3nc4ccccc4n3CCCCOc3c(C)cccc3C)CC2=O)c1 |
| InChI | InChI=1S/C31H35N3O4/c1-21-10-9-11-22(2)30(21)38-17-8-7-16-33-26-13-6-5-12-25(26)32-31(33)23-18-29(35)34(20-23)27-19-24(36-3)14-15-28(27)37-4/h5-6,9-15,19,23H,7-8,16-18,20H2,1-4H3 |
| InChIKey | QLUZVMNHWGDECD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|