C8H17F3N2O4S2 — CID 170039874
N-propan-2-yl-3-(trifluoromethylsulfonylamino)butane-1-sulfonamide (PubChem CID 170039874) has the molecular formula C8H17F3N2O4S2 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-propan-2-yl-3-(trifluoromethylsulfonylamino)butane-1-sulfonamide.
| Compound Name | N-propan-2-yl-3-(trifluoromethylsulfonylamino)butane-1-sulfonamide |
|---|---|
| PubChem CID | 170039874 |
| Molecular Formula | C8H17F3N2O4S2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-propan-2-yl-3-(trifluoromethylsulfonylamino)butane-1-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)CCC(C)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O4S2/c1-6(2)12-18(14,15)5-4-7(3)13-19(16,17)8(9,10)11/h6-7,12-13H,4-5H2,1-3H3 |
| InChIKey | XUEJEXOSQATWPU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |