C30H33N3O3 — CID 17004261
1-(3,5-dimethylphenyl)-4-[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one (PubChem CID 17004261) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4-[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-(3,5-dimethylphenyl)-4-[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17004261 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4-[1-[4-(3-methoxyphenoxy)butyl]benzimidazol-2-yl]pyrrolidin-2-one |
| SMILES | COc1cccc(OCCCCn2c(C3CC(=O)N(c4cc(C)cc(C)c4)C3)nc3ccccc32)c1 |
| InChI | InChI=1S/C30H33N3O3/c1-21-15-22(2)17-24(16-21)33-20-23(18-29(33)34)30-31-27-11-4-5-12-28(27)32(30)13-6-7-14-36-26-10-8-9-25(19-26)35-3/h4-5,8-12,15-17,19,23H,6-7,13-14,18,20H2,1-3H3 |
| InChIKey | OQIBJWMTRFZYBS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|