C18H14N3OPS2 — CID 170044369
3-amino-N-(4-phosphanylphenyl)-6-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 170044369) has the molecular formula C18H14N3OPS2 and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-amino-N-(4-phosphanylphenyl)-6-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(4-phosphanylphenyl)-6-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170044369 |
| Molecular Formula | C18H14N3OPS2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 3-amino-N-(4-phosphanylphenyl)-6-thiophen-2-ylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2ccc(P)cc2)sc2nc(-c3cccs3)ccc12 |
| InChI | InChI=1S/C18H14N3OPS2/c19-15-12-7-8-13(14-2-1-9-24-14)21-18(12)25-16(15)17(22)20-10-3-5-11(23)6-4-10/h1-9H,19,23H2,(H,20,22) |
| InChIKey | AZTFQNIBAIAXSZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|