C18H28N4 — CID 170045696
N-[1-(4-aminophenyl)piperidin-4-yl]-N-methyl-1-azabicyclo[2.2.1]heptan-3-amine (PubChem CID 170045696) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)piperidin-4-yl]-N-methyl-1-azabicyclo[2.2.1]heptan-3-amine.
| Compound Name | N-[1-(4-aminophenyl)piperidin-4-yl]-N-methyl-1-azabicyclo[2.2.1]heptan-3-amine |
|---|---|
| PubChem CID | 170045696 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N-[1-(4-aminophenyl)piperidin-4-yl]-N-methyl-1-azabicyclo[2.2.1]heptan-3-amine |
| SMILES | CN(C1CCN(c2ccc(N)cc2)CC1)C1CN2CCC1C2 |
| InChI | InChI=1S/C18H28N4/c1-20(18-13-21-9-6-14(18)12-21)16-7-10-22(11-8-16)17-4-2-15(19)3-5-17/h2-5,14,16,18H,6-13,19H2,1H3 |
| InChIKey | YBOJYJOROGARJC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|