C25H34N4O4 — CID 170046249
3-[7-[2-(7-ethyl-7-azaspiro[3.5]nonan-2-yl)ethylamino]-1-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170046249) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-[7-[2-(7-ethyl-7-azaspiro[3.5]nonan-2-yl)ethylamino]-1-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[2-(7-ethyl-7-azaspiro[3.5]nonan-2-yl)ethylamino]-1-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170046249 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 3-[7-[2-(7-ethyl-7-azaspiro[3.5]nonan-2-yl)ethylamino]-1-hydroxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCN1CCC2(CC1)CC(CCNc1cccc3c1C(O)N(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C25H34N4O4/c1-2-28-12-9-25(10-13-28)14-16(15-25)8-11-26-18-5-3-4-17-21(18)24(33)29(23(17)32)19-6-7-20(30)27-22(19)31/h3-5,16,19,24,26,33H,2,6-15H2,1H3,(H,27,30,31) |
| InChIKey | ZHOOWWGTUKRLLF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|