C28H40N4O8S — CID 170701934
3-[[(3R)-2-[(3R)-2,6-dioxopiperidin-3-yl]-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]-1-oxo-3H-isoindol-4-yl]amino]propyl methanesulfonate (PubChem CID 170701934) has the molecular formula C28H40N4O8S and a molecular weight of 592.72 g/mol. Its IUPAC name is 3-[[(3R)-2-[(3R)-2,6-dioxopiperidin-3-yl]-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]-1-oxo-3H-isoindol-4-yl]amino]propyl methanesulfonate.
| Compound Name | 3-[[(3R)-2-[(3R)-2,6-dioxopiperidin-3-yl]-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]-1-oxo-3H-isoindol-4-yl]amino]propyl methanesulfonate |
|---|---|
| PubChem CID | 170701934 |
| Molecular Formula | C28H40N4O8S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 3-[[(3R)-2-[(3R)-2,6-dioxopiperidin-3-yl]-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]-1-oxo-3H-isoindol-4-yl]amino]propyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1CCC([C@@H]2c3c(NCCCOS(C)(=O)=O)cccc3C(=O)N2[C@@H]2CCC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C28H40N4O8S/c1-28(2,3)40-27(36)30-18-11-9-17(10-12-18)24-23-19(26(35)32(24)21-13-14-22(33)31-25(21)34)7-5-8-20(23)29-15-6-16-39-41(4,37)38/h5,7-8,17-18,21,24,29H,6,9-16H2,1-4H3,(H,30,36)(H,31,33,34)/t17?,18?,21-,24-/m1/s1 |
| InChIKey | OYWKZZXHEHHMOR-RIHBUBRSSA-N |
| XLogP | 2.85 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|