C29H30FN3O2 — CID 17004627
4-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(4-fluorophenyl)pyrrolidin-2-one (PubChem CID 17004627) has the molecular formula C29H30FN3O2 and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(4-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(4-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17004627 |
| Molecular Formula | C29H30FN3O2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(4-fluorophenyl)pyrrolidin-2-one |
| SMILES | Cc1cccc(OCCCCn2c(C3CC(=O)N(c4ccc(F)cc4)C3)nc3ccccc32)c1C |
| InChI | InChI=1S/C29H30FN3O2/c1-20-8-7-11-27(21(20)2)35-17-6-5-16-32-26-10-4-3-9-25(26)31-29(32)22-18-28(34)33(19-22)24-14-12-23(30)13-15-24/h3-4,7-15,22H,5-6,16-19H2,1-2H3 |
| InChIKey | VTUPSKFVBAJLEA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|