C28H27FN4O3 — CID 170046283
4-(azepan-1-yl)-7-[8-ethynyl-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine (PubChem CID 170046283) has the molecular formula C28H27FN4O3 and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-(azepan-1-yl)-7-[8-ethynyl-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine.
| Compound Name | 4-(azepan-1-yl)-7-[8-ethynyl-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 170046283 |
| Molecular Formula | C28H27FN4O3 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-(azepan-1-yl)-7-[8-ethynyl-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine |
| SMILES | C#Cc1cccc2cc(OCOC)cc(-c3ncc4c(N5CCCCCC5)nc(OC)nc4c3F)c12 |
| InChI | InChI=1S/C28H27FN4O3/c1-4-18-10-9-11-19-14-20(36-17-34-2)15-21(23(18)19)25-24(29)26-22(16-30-25)27(32-28(31-26)35-3)33-12-7-5-6-8-13-33/h1,9-11,14-16H,5-8,12-13,17H2,2-3H3 |
| InChIKey | PEGOTZSHOBXWBM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|