C36H31F5N6O3 — CID 176727421
4-(diazepan-1-yl)-7-[8-ethynyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[1-(3,4,5-trifluorophenyl)azetidin-3-yl]methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 176727421) has the molecular formula C36H31F5N6O3 and a molecular weight of 690.67 g/mol. Its IUPAC name is 4-(diazepan-1-yl)-7-[8-ethynyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[1-(3,4,5-trifluorophenyl)azetidin-3-yl]methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(diazepan-1-yl)-7-[8-ethynyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[1-(3,4,5-trifluorophenyl)azetidin-3-yl]methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 176727421 |
| Molecular Formula | C36H31F5N6O3 |
| Molecular Weight | 690.67 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | 4-(diazepan-1-yl)-7-[8-ethynyl-7-fluoro-3-(methoxymethoxy)naphthalen-1-yl]-8-fluoro-2-[[1-(3,4,5-trifluorophenyl)azetidin-3-yl]methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | C#Cc1c(F)ccc2cc(OCOC)cc(-c3ncc4c(N5CCCCCN5)nc(OCC5CN(c6cc(F)c(F)c(F)c6)C5)nc4c3F)c12 |
| InChI | InChI=1S/C36H31F5N6O3/c1-3-24-27(37)8-7-21-11-23(50-19-48-2)14-25(30(21)24)33-32(41)34-26(15-42-33)35(47-10-6-4-5-9-43-47)45-36(44-34)49-18-20-16-46(17-20)22-12-28(38)31(40)29(39)13-22/h1,7-8,11-15,20,43H,4-6,9-10,16-19H2,2H3 |
| InChIKey | BBLNWLWIFQULSN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.67 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|