C22H21FN2O4S — CID 170046934
methyl 2-(2-fluoro-4-pyrrolidin-1-ylsulfonylphenyl)-4-methylquinoline-7-carboxylate (PubChem CID 170046934) has the molecular formula C22H21FN2O4S and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl 2-(2-fluoro-4-pyrrolidin-1-ylsulfonylphenyl)-4-methylquinoline-7-carboxylate.
| Compound Name | methyl 2-(2-fluoro-4-pyrrolidin-1-ylsulfonylphenyl)-4-methylquinoline-7-carboxylate |
|---|---|
| PubChem CID | 170046934 |
| Molecular Formula | C22H21FN2O4S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | methyl 2-(2-fluoro-4-pyrrolidin-1-ylsulfonylphenyl)-4-methylquinoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(C)cc(-c3ccc(S(=O)(=O)N4CCCC4)cc3F)nc2c1 |
| InChI | InChI=1S/C22H21FN2O4S/c1-14-11-20(24-21-12-15(22(26)29-2)5-7-17(14)21)18-8-6-16(13-19(18)23)30(27,28)25-9-3-4-10-25/h5-8,11-13H,3-4,9-10H2,1-2H3 |
| InChIKey | XQBNFQFYIXEKTA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |