C15H13F2N7O4S — CID 170053022
5-[4-(difluoromethylsulfonylamino)-3-hydroxyphenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carboxamide (PubChem CID 170053022) has the molecular formula C15H13F2N7O4S and a molecular weight of 425.38 g/mol. Its IUPAC name is 5-[4-(difluoromethylsulfonylamino)-3-hydroxyphenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[4-(difluoromethylsulfonylamino)-3-hydroxyphenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170053022 |
| Molecular Formula | C15H13F2N7O4S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 5-[4-(difluoromethylsulfonylamino)-3-hydroxyphenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Nc2cnccn2)n[nH]c1-c1ccc(NS(=O)(=O)C(F)F)c(O)c1 |
| InChI | InChI=1S/C15H13F2N7O4S/c16-15(17)29(27,28)24-8-2-1-7(5-9(8)25)12-11(13(18)26)14(23-22-12)21-10-6-19-3-4-20-10/h1-6,15,24-25H,(H2,18,26)(H2,20,21,22,23) |
| InChIKey | WOXWFVBMISOJBV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|