C15H14N6O — CID 170044357
5-(4-aminophenyl)-3-(pyridin-2-ylamino)-1H-pyrazole-4-carboxamide (PubChem CID 170044357) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 5-(4-aminophenyl)-3-(pyridin-2-ylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-aminophenyl)-3-(pyridin-2-ylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170044357 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-(4-aminophenyl)-3-(pyridin-2-ylamino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Nc2ccccn2)n[nH]c1-c1ccc(N)cc1 |
| InChI | InChI=1S/C15H14N6O/c16-10-6-4-9(5-7-10)13-12(14(17)22)15(21-20-13)19-11-3-1-2-8-18-11/h1-8H,16H2,(H2,17,22)(H2,18,19,20,21) |
| InChIKey | HOUHZDKZOJELFT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|