C14H17N7O — CID 170045361
3-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-5-(4-aminophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 170045361) has the molecular formula C14H17N7O and a molecular weight of 299.34 g/mol. Its IUPAC name is 3-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-5-(4-aminophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 3-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-5-(4-aminophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170045361 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 3-[[(Z)-1-amino-3-(methylamino)prop-2-enylidene]amino]-5-(4-aminophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | CN/C=C\C(N)=N\c1n[nH]c(-c2ccc(N)cc2)c1C(N)=O |
| InChI | InChI=1S/C14H17N7O/c1-18-7-6-10(16)19-14-11(13(17)22)12(20-21-14)8-2-4-9(15)5-3-8/h2-7,18H,15H2,1H3,(H2,17,22)(H3,16,19,20,21)/b7-6- |
| InChIKey | FTGPNCGAUTUJSY-SREVYHEPSA-N |
| XLogP | 0.48 |
| TPSA | 148.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|