C20H16N4 — CID 75511476
N-(4,5-diphenyl-1H-pyrazol-3-yl)pyridin-2-amine (PubChem CID 75511476) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is N-(4,5-diphenyl-1H-pyrazol-3-yl)pyridin-2-amine.
| Compound Name | N-(4,5-diphenyl-1H-pyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 75511476 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-(4,5-diphenyl-1H-pyrazol-3-yl)pyridin-2-amine |
| SMILES | c1ccc(-c2[nH]nc(Nc3ccccn3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N4/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)23-24-20(18)22-17-13-7-8-14-21-17/h1-14H,(H2,21,22,23,24) |
| InChIKey | NVPLASZOJOEZOV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |