C19H26FO7P — CID 170053792
ethyl (E)-3-[3-[2-(2-diethoxyphosphorylacetyl)oxyethyl]-4-fluorophenyl]prop-2-enoate (PubChem CID 170053792) has the molecular formula C19H26FO7P and a molecular weight of 416.38 g/mol. Its IUPAC name is ethyl (E)-3-[3-[2-(2-diethoxyphosphorylacetyl)oxyethyl]-4-fluorophenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[2-(2-diethoxyphosphorylacetyl)oxyethyl]-4-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 170053792 |
| Molecular Formula | C19H26FO7P |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | ethyl (E)-3-[3-[2-(2-diethoxyphosphorylacetyl)oxyethyl]-4-fluorophenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(F)c(CCOC(=O)CP(=O)(OCC)OCC)c1 |
| InChI | InChI=1S/C19H26FO7P/c1-4-24-18(21)10-8-15-7-9-17(20)16(13-15)11-12-25-19(22)14-28(23,26-5-2)27-6-3/h7-10,13H,4-6,11-12,14H2,1-3H3/b10-8+ |
| InChIKey | LFWJDUUWKIRNPC-CSKARUKUSA-N |
| XLogP | 3.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|