C14H23N3O3 — CID 170055220
methyl 1-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl)aziridine-2-carboxylate (PubChem CID 170055220) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 1-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl)aziridine-2-carboxylate.
| Compound Name | methyl 1-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 170055220 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | methyl 1-(3-propan-2-yl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl)aziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1C(=O)N1C2CCC1CN(C(C)C)C2 |
| InChI | InChI=1S/C14H23N3O3/c1-9(2)15-6-10-4-5-11(7-15)17(10)14(19)16-8-12(16)13(18)20-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | UURAVEISOWQVDY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|