C24H33N2+ — CID 170060490
(2S)-1-[2,6-di(propan-2-yl)phenyl]-1,2-dimethyl-3-(2-methylphenyl)-2H-imidazol-1-ium (PubChem CID 170060490) has the molecular formula C24H33N2+ and a molecular weight of 349.54 g/mol. Its IUPAC name is (2S)-1-[2,6-di(propan-2-yl)phenyl]-1,2-dimethyl-3-(2-methylphenyl)-2H-imidazol-1-ium.
| Compound Name | (2S)-1-[2,6-di(propan-2-yl)phenyl]-1,2-dimethyl-3-(2-methylphenyl)-2H-imidazol-1-ium |
|---|---|
| PubChem CID | 170060490 |
| Molecular Formula | C24H33N2+ |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (2S)-1-[2,6-di(propan-2-yl)phenyl]-1,2-dimethyl-3-(2-methylphenyl)-2H-imidazol-1-ium |
| SMILES | Cc1ccccc1N1C=C[N+](C)(c2c(C(C)C)cccc2C(C)C)[C@H]1C |
| InChI | InChI=1S/C24H33N2/c1-17(2)21-12-10-13-22(18(3)4)24(21)26(7)16-15-25(20(26)6)23-14-9-8-11-19(23)5/h8-18,20H,1-7H3/q+1/t20-,26?/m0/s1 |
| InChIKey | YQZQPXZJAWUUGQ-DQUNLGLBSA-N |
| XLogP | 6.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|