C11H15N3 — CID 118314582
(3R)-2,3-dimethyl-4-(2-methylphenyl)-3H-1,2,4-triazole (PubChem CID 118314582) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (3R)-2,3-dimethyl-4-(2-methylphenyl)-3H-1,2,4-triazole.
| Compound Name | (3R)-2,3-dimethyl-4-(2-methylphenyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 118314582 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (3R)-2,3-dimethyl-4-(2-methylphenyl)-3H-1,2,4-triazole |
| SMILES | Cc1ccccc1N1C=NN(C)[C@@H]1C |
| InChI | InChI=1S/C11H15N3/c1-9-6-4-5-7-11(9)14-8-12-13(3)10(14)2/h4-8,10H,1-3H3/t10-/m0/s1 |
| InChIKey | MPRJVFFYHKVTKX-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |