C14H20N2 — CID 143732655
2-methyl-1-(2-methylphenyl)-3-propyl-2H-imidazole (PubChem CID 143732655) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-methyl-1-(2-methylphenyl)-3-propyl-2H-imidazole.
| Compound Name | 2-methyl-1-(2-methylphenyl)-3-propyl-2H-imidazole |
|---|---|
| PubChem CID | 143732655 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-methyl-1-(2-methylphenyl)-3-propyl-2H-imidazole |
| SMILES | CCCN1C=CN(c2ccccc2C)C1C |
| InChI | InChI=1S/C14H20N2/c1-4-9-15-10-11-16(13(15)3)14-8-6-5-7-12(14)2/h5-8,10-11,13H,4,9H2,1-3H3 |
| InChIKey | MSVREZJSSHHCHC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |