C12H18N2 — CID 121449628
(2S)-1,2-dimethyl-3-(2-methylphenyl)imidazolidine (PubChem CID 121449628) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-3-(2-methylphenyl)imidazolidine.
| Compound Name | (2S)-1,2-dimethyl-3-(2-methylphenyl)imidazolidine |
|---|---|
| PubChem CID | 121449628 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (2S)-1,2-dimethyl-3-(2-methylphenyl)imidazolidine |
| SMILES | Cc1ccccc1N1CCN(C)[C@@H]1C |
| InChI | InChI=1S/C12H18N2/c1-10-6-4-5-7-12(10)14-9-8-13(3)11(14)2/h4-7,11H,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | UCMPUTZPKSIAGO-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |